What is the formula of terephthalic acid?
C8H6O4
Terephthalic acid/Formula
Why is it called terephthalic acid?
One of three possible isomers of benzenedicarboxylic acid, the others being phthalic and isophthalic acids. Terephthalic acid is an organic compound with formula C6H4(CO2H)2. The common name is derived from the turpentine-producing tree Pistacia terebinthus and phthalic acid.
What is the Iupac name of terephthalic acid?
| IUPAC Name | terephthalic acid |
|---|---|
| Alternative Names | TEREPHTHALIC ACID p-Phthalic acid 1,4-Benzenedicarboxylic acid benzene-1,4-dicarboxylic acid |
| Molecular Formula | C8H6O4 |
| Molar Mass | 166.132 g/mol |
| InChI | InChI=1S/C8H6O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H,(H,9,10)(H,11,12) |
What is terephthalic acid made from?
Terephthalic acid is produced from p-xylene by oxidation with oxygen. The reaction is carried out in acetic acid and the catalyst used is cobalt (or manganese) acetate and bromide. Phthalic anhydride is made from naphthalene or o-xylene by air oxidation over a heterogeneous catalyst.
What is the empirical formula for terephthalic acid c8h6o4?
Terephthalic acid
| PubChem CID | 7489 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C8H6O4 or C6H4(COOH)2 |
| Synonyms | TEREPHTHALIC ACID 100-21-0 p-Phthalic acid 1,4-Benzenedicarboxylic acid benzene-1,4-dicarboxylic acid More… |
What is the difference between terephthalic acid and phthalic acid?
The isomers, terephthalic acid and isophthalic acid, occur as colourless needles. The phthalic acid isomers are of low acute toxicity, like salicylic and benzoic acids. Phthalic acid is not sensitizing.
What is the use of terephthalic acid?
Terephthalic acid is used in paint as a carrier. Terephthalic acid is used as a raw material to make terephthalate plasticizers such as dioctyl terephthalate and dibutyl terephthalate. It is used in the pharmaceutical industry as a raw material for certain drugs.
What is the empirical formula for terephthalic acid C8H6O4?
What is difference between terephthalic acid and phthalic acid?
What is the product of ethylene glycol and terephthalic acid?
Chemical Reaction between ethylene glycol and terephthalic acid yields BHET.
What is terephthalic acid soluble in?
| Terephthalic acid | |
|---|---|
| Melting point | 427°C in a sealed tube (sublimes at 402°C (675 K) in air) |
| Boiling point | sublimes |
| Solubility in water | 1.7g in 100g H2O at 25°C |
| Solubility | Soluble in Dimethyl sulfoxide, DMF, and alkalies. Slightly soluble in ethanol, methanol, formic acid and sulfuric acid. |
