Is aluminum iodide a molecule?

Aluminum Iodide Formula and Structure The chemical formula of aluminum iodide is AlI3. It is dimeric (means it is made of two identical simpler molecules), consisting of Al2I6, similar to that of AlBr3. The gas-phase characterizes the monomeric and dimeric forms of its structure.

What is the formula for aluminum iodide?

AlI3
Aluminium iodide/Formula

What is the molecular shape of AlI3?

planar
The electron diffraction thermal average bond length, r(g), of AlI3 at 700 K is 2.448(6) A; while those of Al2I6 at 430 K are 2.456(6) A (terminal) and 2.670(8) A (bridging). The equilibrium geometry of the monomer molecule is planar with D(3h) symmetry.

What is the correct formula for aluminium iodate?

Chemical Identifiers

Linear Formula	Al(IO3)3
Pubchem CID	129657299
IUPAC Name	diiodyloxyalumanyl iodate
SMILES	O=I(=O)O[Al](OI(=O)=O)OI(=O)=O
InchI Identifier	InChI=1S/Al.3HIO3/c;32-1(3)4/h;3(H,2,3,4)/q+3;;;/p-3

Is aluminum iodide polar or nonpolar?

Electronegativity is the measure of how strongly an atom attracts electrons towards its electron cloud. This makes sense because iodine is a non-metal and wants electrons to complete its outer shell. The three iodide ions and the one aluminum ion in this Lewis structure result in a neutral charge.

What is the molecular formula of aluminium hydroxide?

Al(OH)3
Aluminium hydroxide/Formula

What is the formula of a binary compound?

Binary compounds are compounds that were made from two different elements. They have a formula of A+B→AB .

Why is Aluminium iodide ionic?

An aluminum ion has a +3 charge, and the iodide ion has a -1 charge. The reason for these charges is aluminum needs to lose three electrons to make its outer shell complete and iodine gains one electron to fill its outer shell. The formula for aluminum iodide is AlI3.

What is the molar mass of aluminum iodide?

407.695 g/mol
Aluminium iodide/Molar mass

How do you find the molar mass of aluminum iodide?

The formula for aluminum iodide is AlI3. The molar mass of aluminum iodide is the sum of the molar mass of aluminum and three times the molar mass of iodine. This results in the molar mass of 407.68 g/mole.

Is aluminum iodide soluble or insoluble?

Aluminium iodide